CAS 2138111-19-8 is the registry number for 3,4-Dihydro-2H-pyrazolo(1,5-e)(1,2,5)thiadiazine-8-carboxylic acid 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1-dioxo-3,4-dihydro-2H-pyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylic acid (CAS 2138111-19-8) is a chemical compound with the molecular formula C6H7N3O4S and a molecular weight of 217.21 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-pyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylic acid. InChIKey: KOGMYSFTCYGILZ-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4S |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-pyrazolo[1,5-e][1,2,5]thiadiazine-8-carboxylic acid |
| InChIKey | KOGMYSFTCYGILZ-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C=N2)C(=O)O)S(=O)(=O)N1 |
Computed by PubChem (NCBI)