Products 290834-98-9

CAS 290834-98-9 is the registry number for 2-((3,5-Dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)thio)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoic acid (CAS 290834-98-9) is a chemical compound with the molecular formula C6H7N3O4S and a molecular weight of 217.21 g/mol. IUPAC name: 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoic acid. InChIKey: RHHZZMNGKMZLIA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O4S
Molecular weight217.21 g/mol
IUPAC name2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanoic acid
InChIKeyRHHZZMNGKMZLIA-UHFFFAOYSA-N
SMILESCC(C(=O)O)SC1=NNC(=O)NC1=O

Computed by PubChem (NCBI)