2-Nitrocyclohexanone, 95+%
cas: 4883-67-4 — see every product listed under this CAS number, including other names
2-Nitrocyclohexanone, 95+% (CAS 4883-67-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A190995-100mg |
| cas | 4883-67-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 1939.00 Pln | |
| Ambeed | 10g | 3029.25 Pln | |
| Ambeed | 25g | 5888.38 Pln | |
| Ambeed | 100g | 18698.81 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 603.15 Pln | |
| BLDpharm | 5g | 1697.20 Pln | |
| BLDpharm | 10g | 2019.31 Pln | |
| BLDpharm | 25g | 4940.51 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
2-nitrocyclohexan-1-one (CAS 4883-67-4) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: 2-nitrocyclohexan-1-one. InChIKey: SZNILIWUUKKNPE-UHFFFAOYSA-N.
| Molecular formula | C6H9NO3 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | 2-nitrocyclohexan-1-one |
| InChIKey | SZNILIWUUKKNPE-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)