CAS 4883-67-4 appears in our catalog under these names: 2-Nitrocyclohexanone, 95%, 2-Nitrocyclohexanone, 2-Nitrocyclohexanone 95+%, 2-NITROCYCLOHEXANONE, 99%, 2-Nitrocyclohexanone, 95+%, 95+%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 2,5g, 100g, 100mg, 5g, 10g, 25g.
2-nitrocyclohexan-1-one (CAS 4883-67-4) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: 2-nitrocyclohexan-1-one. InChIKey: SZNILIWUUKKNPE-UHFFFAOYSA-N.
| Molecular formula | C6H9NO3 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | 2-nitrocyclohexan-1-one |
| InChIKey | SZNILIWUUKKNPE-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)