2-Nitrocyclohexanone, 96%
cas: 4883-67-4 — see every product listed under this CAS number, including other names
2-Nitrocyclohexanone, 96% (CAS 4883-67-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114HSL-50mg |
| cas | 4883-67-4 |
| size | 50mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 146.00 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1350.80 Pln | |
| Chemat | 10g | 2104.40 Pln | |
| Chemat | 25g | 3717.20 Pln | |
| Fluorochem | 1g | 841.39 Pln | |
| Fluorochem | 5g | 1981.61 Pln | |
| Fluorochem | 10g | 3106.22 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 25g | 5506.41 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-nitrocyclohexan-1-one (CAS 4883-67-4) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: 2-nitrocyclohexan-1-one. InChIKey: SZNILIWUUKKNPE-UHFFFAOYSA-N.
| Molecular formula | C6H9NO3 |
|---|---|
| Molecular weight | 143.14 g/mol |
| IUPAC name | 2-nitrocyclohexan-1-one |
| InChIKey | SZNILIWUUKKNPE-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)