cas: 13269-19-7 — see every product listed under this CAS number, including other names
2-Nitropyridin-3-amine 98% (CAS 13269-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139101-1g |
| cas | 13269-19-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 654.06 Pln | |
| Ambeed | 500g | 2973.62 Pln | |
| Ambeed | 1000g | 5003.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139101 |
2-nitropyridin-3-amine (CAS 13269-19-7) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 2-nitropyridin-3-amine. InChIKey: GZBKVUGZEAJYHH-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 2-nitropyridin-3-amine |
| InChIKey | GZBKVUGZEAJYHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)