Products 187881-70-5
CAS 187881-70-5 is the registry number for 2-OH-Isoproturon, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: HPC Standards. Available pack sizes: 1ml.
3-[4-(2-hydroxypropan-2-yl)phenyl]-1,1-dimethylurea (CAS 187881-70-5) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: 3-[4-(2-hydroxypropan-2-yl)phenyl]-1,1-dimethylurea. InChIKey: LXNHEMJQNNQUAT-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-[4-(2-hydroxypropan-2-yl)phenyl]-1,1-dimethylurea |
| InChIKey | LXNHEMJQNNQUAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)NC(=O)N(C)C)O |
Computed by PubChem (NCBI)