cas: 95898-97-8 — see every product listed under this CAS number, including other names
2-Phenyl-2-(pyridin-2-yl)ethanamine, 98% (CAS 95898-97-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A183134-1g |
| cas | 95898-97-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3995.53 Pln | |
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1195.43 Pln | |
| Fluorochem | 1g | 2502.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-phenyl-2-pyridin-2-ylethanamine (CAS 95898-97-8) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 2-phenyl-2-pyridin-2-ylethanamine. InChIKey: ZLAZJIVHGNBAGG-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-phenyl-2-pyridin-2-ylethanamine |
| InChIKey | ZLAZJIVHGNBAGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)C2=CC=CC=N2 |
Computed by PubChem (NCBI)