cas: 879291-27-7 — see every product listed under this CAS number, including other names
2-Phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 97% (CAS 879291-27-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115H29-100mg |
| cas | 879291-27-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1720.40 Pln | |
| Chemat | 10g | 2963.60 Pln | |
| Chemat | 25g | 5862.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 879291-27-7) is a chemical compound with the molecular formula C17H20BNO2 and a molecular weight of 281.2 g/mol. IUPAC name: 2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XLBHFDXPYKKVFI-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XLBHFDXPYKKVFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)