Products 1313518-26-1
CAS 1313518-26-1 is the registry number for 3-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1313518-26-1) is a chemical compound with the molecular formula C17H20BNO2 and a molecular weight of 281.2 g/mol. IUPAC name: 3-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: HVGZFXGNVUDGJL-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 3-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | HVGZFXGNVUDGJL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)