CAS 1349171-28-3 appears in our catalog under these names: 2–(2–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)phenyl)pyridine, 2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (CAS 1349171-28-3) is a chemical compound with the molecular formula C17H20BNO2 and a molecular weight of 281.2 g/mol. IUPAC name: 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine. InChIKey: SQOVXXHEUULZCK-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| InChIKey | SQOVXXHEUULZCK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C3=CC=CC=N3 |
Computed by PubChem (NCBI)