cas: 1011-40-1 — see every product listed under this CAS number, including other names
2-Phenyl-5-thiazolecarboxaldehyde, 97%, 97% (CAS 1011-40-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114RT-100mg |
| cas | 1011-40-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 10g | 712.40 Pln | |
| Chemat | 25g | 1686.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-1,3-thiazole-5-carbaldehyde (CAS 1011-40-1) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-5-carbaldehyde. InChIKey: KKALNCQCDXQTCG-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-5-carbaldehyde |
| InChIKey | KKALNCQCDXQTCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)C=O |
Computed by PubChem (NCBI)