CAS 885950-13-0 appears in our catalog under these names: 2-(3-Thienyl)nicotinaldehyde, 95%, 2-(Thiophen-3-yl)nicotinaldehyde, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
2-thiophen-3-ylpyridine-3-carbaldehyde (CAS 885950-13-0) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 2-thiophen-3-ylpyridine-3-carbaldehyde. InChIKey: HAUWSNYPEZPXNX-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 2-thiophen-3-ylpyridine-3-carbaldehyde |
| InChIKey | HAUWSNYPEZPXNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C2=CSC=C2)C=O |
Computed by PubChem (NCBI)