CAS 1328881-94-2 is the registry number for 2-Ethynyl-6-methoxybenzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethynyl-6-methoxy-1,3-benzothiazole (CAS 1328881-94-2) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 2-ethynyl-6-methoxy-1,3-benzothiazole. InChIKey: WVINCBONUVRGGB-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 2-ethynyl-6-methoxy-1,3-benzothiazole |
| InChIKey | WVINCBONUVRGGB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)C#C |
Computed by PubChem (NCBI)