cas: 130161-46-5 — see every product listed under this CAS number, including other names
2-Phenylpyrimidine-5-carbaldehyde 98% (CAS 130161-46-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A501278-250mg |
| cas | 130161-46-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2534.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A501278 |
2-phenylpyrimidine-5-carbaldehyde (CAS 130161-46-5) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 2-phenylpyrimidine-5-carbaldehyde. InChIKey: AUTGLFSBJLERMV-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-phenylpyrimidine-5-carbaldehyde |
| InChIKey | AUTGLFSBJLERMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(C=N2)C=O |
Computed by PubChem (NCBI)