CAS 857283-60-4 is the registry number for 1-(4-Isocyanatophenyl)-1h-pyrrole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 50mg.
1-(4-isocyanatophenyl)pyrrole (CAS 857283-60-4) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 1-(4-isocyanatophenyl)pyrrole. InChIKey: XZPOEEDBGHTYQC-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 1-(4-isocyanatophenyl)pyrrole |
| InChIKey | XZPOEEDBGHTYQC-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)N=C=O |
Computed by PubChem (NCBI)