cas: 178408-16-7 — see every product listed under this CAS number, including other names
2-Piperazinone,1-Methyl-3-[2-(4-Methylphenyl)-2-Oxoethylidene]-, 95%, 95% (CAS 178408-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136ZT-100mg |
| cas | 178408-16-7 |
| size | 100mg |
| availability | 1.15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2680.40 Pln | |
| Chemat | 1g | 5920.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3Z)-1-methyl-3-[2-(4-methylphenyl)-2-oxoethylidene]piperazin-2-one (CAS 178408-16-7) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: (3Z)-1-methyl-3-[2-(4-methylphenyl)-2-oxoethylidene]piperazin-2-one. InChIKey: KSTKBIKZMQMAMQ-XFXZXTDPSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (3Z)-1-methyl-3-[2-(4-methylphenyl)-2-oxoethylidene]piperazin-2-one |
| InChIKey | KSTKBIKZMQMAMQ-XFXZXTDPSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)/C=C\2/C(=O)N(CCN2)C |
Computed by PubChem (NCBI)