CAS 1153370-36-5 is the registry number for 3,5-Dimethyl-1-[(3-methylphenyl)methyl]-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazole-4-carboxylic acid (CAS 1153370-36-5) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazole-4-carboxylic acid. InChIKey: OPTGZLJSEDGOTK-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 3,5-dimethyl-1-[(3-methylphenyl)methyl]pyrazole-4-carboxylic acid |
| InChIKey | OPTGZLJSEDGOTK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C(=C(C(=N2)C)C(=O)O)C |
Computed by PubChem (NCBI)