Products 121911-03-3

CAS 121911-03-3 is the registry number for (1,3,4,9-Tetrahydro-b-carbolin-2-yl)-acetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetate (CAS 121911-03-3) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: methyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetate. InChIKey: QVVKPCJAOVAHNN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N2O2
Molecular weight244.29 g/mol
IUPAC namemethyl 2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)acetate
InChIKeyQVVKPCJAOVAHNN-UHFFFAOYSA-N
SMILESCOC(=O)CN1CCC2=C(C1)NC3=CC=CC=C23

Computed by PubChem (NCBI)