cas: 876376-75-9 — see every product listed under this CAS number, including other names
2-Propen-1-one, 1-(3-chlorophenyl)-3-(dimethylamino)-, (2E)-, 98%, 98% (CAS 876376-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEPG-100mg |
| cas | 876376-75-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 645.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 876376-75-9) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: (E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: LDBZHHVGVAIVBT-VOTSOKGWSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (E)-1-(3-chlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | LDBZHHVGVAIVBT-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)