Products 859239-22-8
CAS 859239-22-8 appears in our catalog under these names: (5-Phenylfuran-2-yl)methanamine hydrochloride, 95%, (5-Phenylfuran-2-yl)methanamine hydrochloride, 98%, (5-Phenylfuran-2-yl)methanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(5-phenylfuran-2-yl)methanamine;hydrochloride (CAS 859239-22-8) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: (5-phenylfuran-2-yl)methanamine;hydrochloride. InChIKey: GLYBBXUKRBICOF-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (5-phenylfuran-2-yl)methanamine;hydrochloride |
| InChIKey | GLYBBXUKRBICOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(O2)CN.Cl |
Computed by PubChem (NCBI)