CAS 329187-43-1 is the registry number for 4-(5-Methyl-2-furyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-(5-methylfuran-2-yl)aniline;hydrochloride (CAS 329187-43-1) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 4-(5-methylfuran-2-yl)aniline;hydrochloride. InChIKey: NGHXMMAWOQGJBC-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 4-(5-methylfuran-2-yl)aniline;hydrochloride |
| InChIKey | NGHXMMAWOQGJBC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)