cas: 960309-85-7 — see every product listed under this CAS number, including other names
2-bromo-1-(tert-butoxy)-4-nitrobenzene, 95%, 95% (CAS 960309-85-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJR0-250mg |
| cas | 960309-85-7 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 491.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-[(2-methylpropan-2-yl)oxy]-4-nitrobenzene (CAS 960309-85-7) is a chemical compound with the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. IUPAC name: 2-bromo-1-[(2-methylpropan-2-yl)oxy]-4-nitrobenzene. InChIKey: KMOHHDFKKROOFJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 2-bromo-1-[(2-methylpropan-2-yl)oxy]-4-nitrobenzene |
| InChIKey | KMOHHDFKKROOFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)