CAS 2026639-11-0 is the registry number for 4-Bromo-N,3-dimethoxy-N-methylbenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-N,3-dimethoxy-N-methylbenzamide (CAS 2026639-11-0) is a chemical compound with the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. IUPAC name: 4-bromo-N,3-dimethoxy-N-methylbenzamide. InChIKey: XLPDBAVHBJUUTG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 4-bromo-N,3-dimethoxy-N-methylbenzamide |
| InChIKey | XLPDBAVHBJUUTG-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC(=C(C=C1)Br)OC)OC |
Computed by PubChem (NCBI)