Products 1087659-21-9
CAS 1087659-21-9 appears in our catalog under these names: 5-Bromopyridin-3-yl tert-butyl carbonate, 95%, 5-Bromopyridin-3-yl tert-butyl carbonate, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(5-bromo-3-pyridinyl) tert-butyl carbonate (CAS 1087659-21-9) is a chemical compound with the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. IUPAC name: (5-bromo-3-pyridinyl) tert-butyl carbonate. InChIKey: PTJSDWLLHABFKV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | (5-bromo-3-pyridinyl) tert-butyl carbonate |
| InChIKey | PTJSDWLLHABFKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)