cas: 1034325-63-7 — see every product listed under this CAS number, including other names
2-bromo-6-fluoro-4-(trifluoromethyl)aniline, 95%, 95% (CAS 1034325-63-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107ZM-100mg |
| cas | 1034325-63-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-fluoro-4-(trifluoromethyl)aniline (CAS 1034325-63-7) is a chemical compound with the molecular formula C7H4BrF4N and a molecular weight of 258.01 g/mol. IUPAC name: 2-bromo-6-fluoro-4-(trifluoromethyl)aniline. InChIKey: HUESCFUGEVOOKM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF4N |
|---|---|
| Molecular weight | 258.01 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-(trifluoromethyl)aniline |
| InChIKey | HUESCFUGEVOOKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)