cas: 70783-75-4 — see every product listed under this CAS number, including other names
2-chloro-4-(trifluoromethoxy)phenol, ≥98%, ≥98% (CAS 70783-75-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FB7U-1g |
| cas | 70783-75-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 990.80 Pln | |
| Chemat | 25g | 3419.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-(trifluoromethoxy)phenol (CAS 70783-75-4) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 2-chloro-4-(trifluoromethoxy)phenol. InChIKey: LSTYNKXVEMLNBE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethoxy)phenol |
| InChIKey | LSTYNKXVEMLNBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Cl)O |
Computed by PubChem (NCBI)