Products 1261878-39-0
CAS 1261878-39-0 is the registry number for 3-Chloro-2-(trifluoromethoxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-2-(trifluoromethoxy)phenol (CAS 1261878-39-0) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 3-chloro-2-(trifluoromethoxy)phenol. InChIKey: QPHCXZCOHMJKFP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 3-chloro-2-(trifluoromethoxy)phenol |
| InChIKey | QPHCXZCOHMJKFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OC(F)(F)F)O |
Computed by PubChem (NCBI)