CAS 139625-85-7 appears in our catalog under these names: 2-Chloro-5-(trifluoromethoxy)phenol, 98%, 2-Chloro-5-(trifluoromethoxy)phenol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g.
2-chloro-5-(trifluoromethoxy)phenol (CAS 139625-85-7) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 2-chloro-5-(trifluoromethoxy)phenol. InChIKey: UKASVHZCKSRNNA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethoxy)phenol |
| InChIKey | UKASVHZCKSRNNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)O)Cl |
Computed by PubChem (NCBI)