cas: 765916-91-4 — see every product listed under this CAS number, including other names
2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%, 97% (CAS 765916-91-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116JCL-100mg |
| cas | 765916-91-4 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 10g | 654.80 Pln | |
| Chemat | 25g | 1538.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 765916-91-4) is a chemical compound with the molecular formula C13H15BFNO2 and a molecular weight of 247.07 g/mol. IUPAC name: 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: TXGKJULMHJEZTA-UHFFFAOYSA-N.
| Molecular formula | C13H15BFNO2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | TXGKJULMHJEZTA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)