Products 2377607-87-7
CAS 2377607-87-7 appears in our catalog under these names: 5-(1-Cyanocyclohexyl)-2-fluorophenylboronic acid, 98%, (5-(1-Cyanocyclohexyl)-2-fluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
[5-(1-cyanocyclohexyl)-2-fluorophenyl]boronic acid (CAS 2377607-87-7) is a chemical compound with the molecular formula C13H15BFNO2 and a molecular weight of 247.07 g/mol. IUPAC name: [5-(1-cyanocyclohexyl)-2-fluorophenyl]boronic acid. InChIKey: FHZWUCOLZQGZHY-UHFFFAOYSA-N.
| Molecular formula | C13H15BFNO2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | [5-(1-cyanocyclohexyl)-2-fluorophenyl]boronic acid |
| InChIKey | FHZWUCOLZQGZHY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2(CCCCC2)C#N)F)(O)O |
Computed by PubChem (NCBI)