Products 463335-96-8

CAS 463335-96-8 is the registry number for 2-Cyano-5-fluorophenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 463335-96-8) is a chemical compound with the molecular formula C13H15BFNO2 and a molecular weight of 247.07 g/mol. IUPAC name: 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: ZULLJYIMHRJPQA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15BFNO2
Molecular weight247.07 g/mol
IUPAC name4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
InChIKeyZULLJYIMHRJPQA-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C#N

Computed by PubChem (NCBI)