CAS 463335-96-8 is the registry number for 2-Cyano-5-fluorophenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 463335-96-8) is a chemical compound with the molecular formula C13H15BFNO2 and a molecular weight of 247.07 g/mol. IUPAC name: 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: ZULLJYIMHRJPQA-UHFFFAOYSA-N.
| Molecular formula | C13H15BFNO2 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | ZULLJYIMHRJPQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C#N |
Computed by PubChem (NCBI)