cas: 83-72-7 — see every product listed under this CAS number, including other names
2-hydroxynaphthalene-1,4-dione, 95%, 95% (CAS 83-72-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 15g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147HM-5g |
| cas | 83-72-7 |
| size | 5g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 15g | 141.20 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 232.40 Pln | |
| Chemat | 100g | 405.20 Pln | |
| Chemat | 250g | 899.60 Pln | |
| Chemat | 500g | 1694.40 Pln | |
| Chemat | 1kg | 3069.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Lawsone is 1,4-Naphthoquinone carrying a hydroxy function at C-2. It is obtained from the leaves of Lawsonia inermis. It has a role as an antifungal agent and a protective agent. It is a tautomer of a naphthalene-1,2,4-trione.
Source: ChEBI
| Molecular formula | C10H6O3 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 4-hydroxynaphthalene-1,2-dione |
| InChIKey | WVCHIGAIXREVNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=O)O |
Computed by PubChem (NCBI)