CAS 15448-58-5 appears in our catalog under these names: 1Ah,2h,7h,7ah-naphtho[2,3-b]oxirene-2,7-dione, 95%, Naphtho[2,3-b]oxirene-2,7(1aH,7aH)-dione. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5mg, 25mg.
1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione (CAS 15448-58-5) is a chemical compound with the molecular formula C10H6O3 and a molecular weight of 174.15 g/mol. IUPAC name: 1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione. InChIKey: TVVRFUOKLKGUKT-UHFFFAOYSA-N.
| Molecular formula | C10H6O3 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| InChIKey | TVVRFUOKLKGUKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3C(C2=O)O3 |
Computed by PubChem (NCBI)