CAS 26856-06-4 is the registry number for 5–Vinyl–2–benzofuran–1,3–dione. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
5-ethenyl-2-benzofuran-1,3-dione (CAS 26856-06-4) is a chemical compound with the molecular formula C10H6O3 and a molecular weight of 174.15 g/mol. IUPAC name: 5-ethenyl-2-benzofuran-1,3-dione. InChIKey: OHMDZMAJDUVGHO-UHFFFAOYSA-N.
| Molecular formula | C10H6O3 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | 5-ethenyl-2-benzofuran-1,3-dione |
| InChIKey | OHMDZMAJDUVGHO-UHFFFAOYSA-N |
| SMILES | C=CC1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)