cas: 936728-23-3 — see every product listed under this CAS number, including other names
2-methoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 96%, 96% (CAS 936728-23-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHQG-100mg |
| cas | 936728-23-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1494.80 Pln | |
| Chemat | 5g | 5786.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 936728-23-3) is a chemical compound with the molecular formula C14H19BO5 and a molecular weight of 278.11 g/mol. IUPAC name: 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: YTRKFPQHYQIWMA-UHFFFAOYSA-N.
| Molecular formula | C14H19BO5 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | YTRKFPQHYQIWMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)OC |
Computed by PubChem (NCBI)