Products 1421322-59-9
CAS 1421322-59-9 is the registry number for Methyl 2-hydroxy-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Methyl 2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1421322-59-9) is a chemical compound with the molecular formula C14H19BO5 and a molecular weight of 278.11 g/mol. IUPAC name: methyl 2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: UIHVCARBMYLMPE-UHFFFAOYSA-N.
| Molecular formula | C14H19BO5 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | methyl 2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | UIHVCARBMYLMPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(=O)OC)O |
Computed by PubChem (NCBI)