CAS 936728-20-0 appears in our catalog under these names: 3-Carboxy-5-methoxyphenylboronic acid, pinacol ester, 98%, 3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid 98%, 3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%, 98%, 3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 936728-20-0) is a chemical compound with the molecular formula C14H19BO5 and a molecular weight of 278.11 g/mol. IUPAC name: 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: ZEDIRMKDJWTATP-UHFFFAOYSA-N.
| Molecular formula | C14H19BO5 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | ZEDIRMKDJWTATP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)