cas: 2246676-49-1 — see every product listed under this CAS number, including other names
2-methyl-N-[2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide, 98%, 98% (CAS 2246676-49-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11QIHS-100mg |
| cas | 2246676-49-1 |
| size | 100mg |
| availability | 5.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (CAS 2246676-49-1) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: 2-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide. InChIKey: DTYSXQCMDQRNQS-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 2-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| InChIKey | DTYSXQCMDQRNQS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2NC(=O)C(C)C |
Computed by PubChem (NCBI)