CAS 1073371-90-0 appears in our catalog under these names: 2-(Cyclopentyloxy)pyridine-3-boronic acid, pinacol ester, 98%, 2-Cyclopentyloxypyridine-3-boronic acid pinacol ester, 96% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg, 100mg.
2-cyclopentyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073371-90-0) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: 2-cyclopentyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GZCZGFSEHAZEPS-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 2-cyclopentyloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GZCZGFSEHAZEPS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)OC3CCCC3 |
Computed by PubChem (NCBI)