CAS 2096337-88-9 appears in our catalog under these names: 3-(N,N-Dimethylcarbamoyl)-5-methylphenylboronic acid, pinacol ester, 96%, N,N,3-Trimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
N,N,3-trimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2096337-88-9) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: N,N,3-trimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: ULDQNDKNUNYZAS-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | N,N,3-trimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | ULDQNDKNUNYZAS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)N(C)C)C |
Computed by PubChem (NCBI)