cas: 1091627-77-8 — see every product listed under this CAS number, including other names
22-Amino-5,8,11,14,17,20-hexaoxa-2-azadocosanoic acid 1,1-dimethylethyl ester, 98%, 98% (CAS 1091627-77-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119V1F-50mg |
| cas | 1091627-77-8 |
| size | 50mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3165.20 Pln | |
| Chemat | 50g | 4888.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1091627-77-8) is a chemical compound with the molecular formula C19H40N2O8 and a molecular weight of 424.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: HYSRAUNKYCBBFY-UHFFFAOYSA-N.
| Molecular formula | C19H40N2O8 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | HYSRAUNKYCBBFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)