Boc-NH-PEG6-amine, 97.0%
cas: 1091627-77-8 — see every product listed under this CAS number, including other names
Boc-NH-PEG6-amine, 97.0% (CAS 1091627-77-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 50 mg, 1 g, 100 mg, 25 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-140231-10 g |
| cas | 1091627-77-8 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 5158.74 Pln | |
| MedChemExpress | 5 g | 3236.12 Pln | |
| MedChemExpress | 50 mg | 347.56 Pln | |
| MedChemExpress | 1 g | 1150.97 Pln | |
| MedChemExpress | 100 mg | 417.22 Pln | |
| MedChemExpress | 25 g | 10912.66 Pln | |
| MedChemExpress | 250 mg | 737.65 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1091627-77-8) is a chemical compound with the molecular formula C19H40N2O8 and a molecular weight of 424.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: HYSRAUNKYCBBFY-UHFFFAOYSA-N.
| Molecular formula | C19H40N2O8 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | HYSRAUNKYCBBFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)