Boc-NH-PEG6-NH2, 97%
cas: 1091627-77-8 — see every product listed under this CAS number, including other names
Boc-NH-PEG6-NH2, 97% (CAS 1091627-77-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545409-50MG |
| cas | 1091627-77-8 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 164.54 Pln | |
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1684.84 Pln | |
| Fluorochem | 10g | 2825.06 Pln | |
| Fluorochem | 25g | 5235.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 1091627-77-8) is a chemical compound with the molecular formula C19H40N2O8 and a molecular weight of 424.5 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: HYSRAUNKYCBBFY-UHFFFAOYSA-N.
| Molecular formula | C19H40N2O8 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | HYSRAUNKYCBBFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)