CAS 1198154-30-1 is the registry number for 2H-[1,4]Oxazino[3,2-c]quinolin-3(4H)-one, 95%. Offered by: Ambeed. Available pack sizes: 100mg.
4H-[1,4]oxazino[3,2-c]quinolin-3-one (CAS 1198154-30-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 4H-[1,4]oxazino[3,2-c]quinolin-3-one. InChIKey: HFSVXGWCDCXVIG-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4H-[1,4]oxazino[3,2-c]quinolin-3-one |
| InChIKey | HFSVXGWCDCXVIG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)