cas: 15884-65-8 — see every product listed under this CAS number, including other names
2H-1,3-benzodioxole-5-carbothioamide, 98% (CAS 15884-65-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F356264-1G |
| cas | 15884-65-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1924.34 Pln | |
| Fluorochem | 10g | 3236.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,3-benzodioxole-5-carbothioamide (CAS 15884-65-8) is a chemical compound with the molecular formula C8H7NO2S and a molecular weight of 181.21 g/mol. IUPAC name: 1,3-benzodioxole-5-carbothioamide. InChIKey: YHXXBQMLJHUUJU-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 1,3-benzodioxole-5-carbothioamide |
| InChIKey | YHXXBQMLJHUUJU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=S)N |
Computed by PubChem (NCBI)