CAS 2642-63-9 appears in our catalog under these names: 3',4'-Dichloroacetophenone, 98%, 3',4'–Dichloroacetophenone, 3',4'-Dichloroacetophenone, 98+% , 3',4'-Dichloroacetophenone, 3',4'-Dichloroacetophenone, >98.0%(GC). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 1000g, 1x1000mg, 1g.
1-(3,4-dichlorophenyl)ethanone (CAS 2642-63-9) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)ethanone. InChIKey: WBPAOUHWPONFEQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)ethanone |
| InChIKey | WBPAOUHWPONFEQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)