cas: 510758-19-7 — see every product listed under this CAS number, including other names
3',6'-Dihydroxy-3-oxo-N-(prop-2-yn-1-yl)-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carboxamide, 97% (CAS 510758-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Fluorochem, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F546083-1MG |
| cas | 510758-19-7 |
| size | 1mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1mg | 487.35 Pln | |
| Fluorochem | 5mg | 1388.07 Pln | |
| Fluorochem | 10mg | 2351.27 Pln | |
| Fluorochem | 25mg | 3288.44 Pln | |
| BLDpharm | 10mg | 503.18 Pln | |
| BLDpharm | 25mg | 886.38 Pln | |
| BLDpharm | 50mg | 1452.85 Pln | |
| BLDpharm | 100mg | 2680.19 Pln | |
| BLDpharm | 250mg | 5023.81 Pln | |
| Chemat | 50mg | 1576.40 Pln | |
| Chemat | 100mg | 2637.20 Pln | |
| Fluorochem | 100mg | 4886.84 Pln | |
| Fluorochem | 50mg | 2934.40 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3',6'-dihydroxy-3-oxo-N-prop-2-ynylspiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (CAS 510758-19-7) is a chemical compound with the molecular formula C24H15NO6 and a molecular weight of 413.4 g/mol. IUPAC name: 3',6'-dihydroxy-3-oxo-N-prop-2-ynylspiro[2-benzofuran-1,9'-xanthene]-5-carboxamide. InChIKey: UNBAJBIGCBVWJU-UHFFFAOYSA-N.
| Molecular formula | C24H15NO6 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 3',6'-dihydroxy-3-oxo-N-prop-2-ynylspiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| InChIKey | UNBAJBIGCBVWJU-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Computed by PubChem (NCBI)