CAS 478801-49-9 appears in our catalog under these names: FAM alkyne, 6-isomer, 95%, FAM alkyne, 6–isomer, FAM alkyne, 6-isomer 97%, FAM ALKYNE, 6-ISOMER, 97%, 97%, FAM alkyne, 6-isomer. Offered by: Lumiprobe, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg.
3',6'-dihydroxy-1-oxo-N-prop-2-ynylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (CAS 478801-49-9) is a chemical compound with the molecular formula C24H15NO6 and a molecular weight of 413.4 g/mol. IUPAC name: 3',6'-dihydroxy-1-oxo-N-prop-2-ynylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide. InChIKey: OCTDWUOGUCSHAK-UHFFFAOYSA-N.
| Molecular formula | C24H15NO6 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 3',6'-dihydroxy-1-oxo-N-prop-2-ynylspiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| InChIKey | OCTDWUOGUCSHAK-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC2=C(C=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)