CAS 510758-19-7 appears in our catalog under these names: FAM alkyne, 5-isomer, 95%, 3',6'-Dihydroxy-3-oxo-n-(prop-2-yn-1-yl)-3h-spiro[isobenzofuran-1,9'-xanthene]-5-carboxamide, 95%, FAM alkyne, 5–isomer, 5-FAM-Alkyne, 5-FAM-Alkyne 97%. Offered by: Lumiprobe, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10mM/1mL.
3',6'-dihydroxy-3-oxo-N-prop-2-ynylspiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (CAS 510758-19-7) is a chemical compound with the molecular formula C24H15NO6 and a molecular weight of 413.4 g/mol. IUPAC name: 3',6'-dihydroxy-3-oxo-N-prop-2-ynylspiro[2-benzofuran-1,9'-xanthene]-5-carboxamide. InChIKey: UNBAJBIGCBVWJU-UHFFFAOYSA-N.
| Molecular formula | C24H15NO6 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 3',6'-dihydroxy-3-oxo-N-prop-2-ynylspiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| InChIKey | UNBAJBIGCBVWJU-UHFFFAOYSA-N |
| SMILES | C#CCNC(=O)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Computed by PubChem (NCBI)